About 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine
3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine (PubChem CID 130706404) has the molecular formula C9H13FN2S
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine |
| PubChem CID | 130706404 |
| Molecular Formula | C9H13FN2S |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine |
| SMILES | NC1CCCC(F)(c2ccsn2)C1 |
| InChI | InChI=1S/C9H13FN2S/c10-9(8-3-5-13-12-8)4-1-2-7(11)6-9/h3,5,7H,1-2,4,6,11H2 |
| InChIKey | GIWPFTHDLPMCJC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine?
The IUPAC name of 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine (CID 130706404) is 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine.
What is the SMILES notation for 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine?
The canonical SMILES for 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine is NC1CCCC(F)(c2ccsn2)C1.
What is the InChIKey of 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine?
The InChIKey is GIWPFTHDLPMCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2S/c10-9(8-3-5-13-12-8)4-1-2-7(11)6-9/h3,5,7H,1-2,4,6,11H2.
What are the key properties of 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine?
3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine has a molecular weight of 200.28 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-(1,2-thiazol-3-yl)cyclohexan-1-amine is sourced from PubChem (CID 130706404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).