About 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride
1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride (PubChem CID 13070746) has the molecular formula C8H13ClN2
and a molecular weight of 172.66 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride |
| PubChem CID | 13070746 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride |
| SMILES | CC1=CCN(C)C(C#N)C1.Cl |
| InChI | InChI=1S/C8H12N2.ClH/c1-7-3-4-10(2)8(5-7)6-9;/h3,8H,4-5H2,1-2H3;1H |
| InChIKey | DGERRQBZNJLMDO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride?
The IUPAC name of 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride (CID 13070746) is 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride.
What is the SMILES notation for 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride?
The canonical SMILES for 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride is CC1=CCN(C)C(C#N)C1.Cl.
What is the InChIKey of 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride?
The InChIKey is DGERRQBZNJLMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.ClH/c1-7-3-4-10(2)8(5-7)6-9;/h3,8H,4-5H2,1-2H3;1H.
What are the key properties of 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride?
1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride has a molecular weight of 172.66 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-3,6-dihydro-2H-pyridine-2-carbonitrile;hydrochloride is sourced from PubChem (CID 13070746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).