About 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane
5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane (PubChem CID 130708197) has the molecular formula C8H14ClNS2
and a molecular weight of 223.79 g/mol. Its IUPAC name is 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane.
Molecular Properties
| Compound Name | 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane |
| PubChem CID | 130708197 |
| Molecular Formula | C8H14ClNS2 |
| Molecular Weight | 223.79 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane |
| SMILES | C=C(CCl)CN1CCSSCC1 |
| InChI | InChI=1S/C8H14ClNS2/c1-8(6-9)7-10-2-4-11-12-5-3-10/h1-7H2 |
| InChIKey | QBCZJEMLRJOPMC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane?
The IUPAC name of 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane (CID 130708197) is 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane.
What is the SMILES notation for 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane?
The canonical SMILES for 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane is C=C(CCl)CN1CCSSCC1.
What is the InChIKey of 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane?
The InChIKey is QBCZJEMLRJOPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNS2/c1-8(6-9)7-10-2-4-11-12-5-3-10/h1-7H2.
What are the key properties of 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane?
5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane has a molecular weight of 223.79 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(chloromethyl)prop-2-enyl]-1,2,5-dithiazepane is sourced from PubChem (CID 130708197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).