C9H15FN2O — CID 130709246
3-fluoro-1-[(2S)-2-hydroxybutyl]pyrrolidine-3-carbonitrile (PubChem CID 130709246) has the molecular formula C9H15FN2O and a molecular weight of 186.23 g/mol. Its IUPAC name is 3-fluoro-1-[(2S)-2-hydroxybutyl]pyrrolidine-3-carbonitrile.
| Compound Name | 3-fluoro-1-[(2S)-2-hydroxybutyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 130709246 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-fluoro-1-[(2S)-2-hydroxybutyl]pyrrolidine-3-carbonitrile |
| SMILES | CC[C@H](O)CN1CCC(F)(C#N)C1 |
| InChI | InChI=1S/C9H15FN2O/c1-2-8(13)5-12-4-3-9(10,6-11)7-12/h8,13H,2-5,7H2,1H3/t8-,9?/m0/s1 |
| InChIKey | OZXWEFGSROQDPX-IENPIDJESA-N |
| XLogP | 0.69 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |