C9H14N2O2 — CID 130710840
N-[(1R)-1-cyanoethyl]-2-[(3R)-oxolan-3-yl]acetamide (PubChem CID 130710840) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is N-[(1R)-1-cyanoethyl]-2-[(3R)-oxolan-3-yl]acetamide.
| Compound Name | N-[(1R)-1-cyanoethyl]-2-[(3R)-oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 130710840 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N-[(1R)-1-cyanoethyl]-2-[(3R)-oxolan-3-yl]acetamide |
| SMILES | C[C@H](C#N)NC(=O)C[C@H]1CCOC1 |
| InChI | InChI=1S/C9H14N2O2/c1-7(5-10)11-9(12)4-8-2-3-13-6-8/h7-8H,2-4,6H2,1H3,(H,11,12)/t7-,8-/m1/s1 |
| InChIKey | SBRRMOISYOBTOS-HTQZYQBOSA-N |
| XLogP | 0.44 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |