C8H5Cl2NOS2 — CID 130713176
[2-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 130713176) has the molecular formula C8H5Cl2NOS2 and a molecular weight of 266.17 g/mol. Its IUPAC name is [2-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 130713176 |
| Molecular Formula | C8H5Cl2NOS2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 264.92 |
| IUPAC Name | [2-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1cnc(-c2cc(Cl)sc2Cl)s1 |
| InChI | InChI=1S/C8H5Cl2NOS2/c9-6-1-5(7(10)14-6)8-11-2-4(3-12)13-8/h1-2,12H,3H2 |
| InChIKey | WYBAOSFLGFKENU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |