About (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile
(4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile (PubChem CID 130713754) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile.
Molecular Properties
| Compound Name | (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile |
| PubChem CID | 130713754 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile |
| SMILES | N#Cc1cccc2c1[C@H](N)COC2 |
| InChI | InChI=1S/C10H10N2O/c11-4-7-2-1-3-8-5-13-6-9(12)10(7)8/h1-3,9H,5-6,12H2/t9-/m1/s1 |
| InChIKey | IUQVGQAQXJOWRN-SECBINFHSA-N |
| XLogP | 1.09 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile?
The IUPAC name of (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile (CID 130713754) is (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile.
What is the SMILES notation for (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile?
The canonical SMILES for (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile is N#Cc1cccc2c1[C@H](N)COC2.
What is the InChIKey of (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile?
The InChIKey is IUQVGQAQXJOWRN-SECBINFHSA-N. The full InChI is InChI=1S/C10H10N2O/c11-4-7-2-1-3-8-5-13-6-9(12)10(7)8/h1-3,9H,5-6,12H2/t9-/m1/s1.
What are the key properties of (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile?
(4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile has a molecular weight of 174.20 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-amino-3,4-dihydro-1H-isochromene-5-carbonitrile is sourced from PubChem (CID 130713754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).