C20H24BrNO5 — CID 13071440
1-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,2'-1,3-dioxolane]-2-carbaldehyde (PubChem CID 13071440) has the molecular formula C20H24BrNO5 and a molecular weight of 438.32 g/mol. Its IUPAC name is 1-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,2'-1,3-dioxolane]-2-carbaldehyde.
| Compound Name | 1-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,2'-1,3-dioxolane]-2-carbaldehyde |
|---|---|
| PubChem CID | 13071440 |
| Molecular Formula | C20H24BrNO5 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 1-[(2-bromo-5-hydroxy-4-methoxyphenyl)methyl]spiro[1,3,4,5,7,8-hexahydroisoquinoline-6,2'-1,3-dioxolane]-2-carbaldehyde |
| SMILES | COc1cc(Br)c(CC2C3=C(CCN2C=O)CC2(CC3)OCCO2)cc1O |
| InChI | InChI=1S/C20H24BrNO5/c1-25-19-10-16(21)14(9-18(19)24)8-17-15-2-4-20(26-6-7-27-20)11-13(15)3-5-22(17)12-23/h9-10,12,17,24H,2-8,11H2,1H3 |
| InChIKey | KPNPWTRAXLZHMG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|