About (2R)-2-(2,3-dimethylphenyl)azetidine
(2R)-2-(2,3-dimethylphenyl)azetidine (PubChem CID 130714481) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylphenyl)azetidine.
Molecular Properties
| Compound Name | (2R)-2-(2,3-dimethylphenyl)azetidine |
| PubChem CID | 130714481 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2R)-2-(2,3-dimethylphenyl)azetidine |
| SMILES | Cc1cccc([C@H]2CCN2)c1C |
| InChI | InChI=1S/C11H15N/c1-8-4-3-5-10(9(8)2)11-6-7-12-11/h3-5,11-12H,6-7H2,1-2H3/t11-/m1/s1 |
| InChIKey | CSLGALAUTYFBAG-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-(2,3-dimethylphenyl)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,3-dimethylphenyl)azetidine?
The IUPAC name of (2R)-2-(2,3-dimethylphenyl)azetidine (CID 130714481) is (2R)-2-(2,3-dimethylphenyl)azetidine.
What is the SMILES notation for (2R)-2-(2,3-dimethylphenyl)azetidine?
The canonical SMILES for (2R)-2-(2,3-dimethylphenyl)azetidine is Cc1cccc([C@H]2CCN2)c1C.
What is the InChIKey of (2R)-2-(2,3-dimethylphenyl)azetidine?
The InChIKey is CSLGALAUTYFBAG-LLVKDONJSA-N. The full InChI is InChI=1S/C11H15N/c1-8-4-3-5-10(9(8)2)11-6-7-12-11/h3-5,11-12H,6-7H2,1-2H3/t11-/m1/s1.
What are the key properties of (2R)-2-(2,3-dimethylphenyl)azetidine?
(2R)-2-(2,3-dimethylphenyl)azetidine has a molecular weight of 161.25 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,3-dimethylphenyl)azetidine is sourced from PubChem (CID 130714481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).