C9H21NO — CID 130714780
(3R)-3-amino-2,2,4,4-tetramethylpentan-1-ol (PubChem CID 130714780) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is (3R)-3-amino-2,2,4,4-tetramethylpentan-1-ol.
| Compound Name | (3R)-3-amino-2,2,4,4-tetramethylpentan-1-ol |
|---|---|
| PubChem CID | 130714780 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | (3R)-3-amino-2,2,4,4-tetramethylpentan-1-ol |
| SMILES | CC(C)(C)[C@@H](N)C(C)(C)CO |
| InChI | InChI=1S/C9H21NO/c1-8(2,3)7(10)9(4,5)6-11/h7,11H,6,10H2,1-5H3/t7-/m1/s1 |
| InChIKey | WOWCAMIPDVSYRH-SSDOTTSWSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |