C9H18IN3 — CID 130714979
N'-(2-methylprop-2-enyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 130714979) has the molecular formula C9H18IN3 and a molecular weight of 295.17 g/mol. Its IUPAC name is N'-(2-methylprop-2-enyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-methylprop-2-enyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 130714979 |
| Molecular Formula | C9H18IN3 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N'-(2-methylprop-2-enyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)N1CCCC1.I |
| InChI | InChI=1S/C9H17N3.HI/c1-8(2)7-11-9(10)12-5-3-4-6-12;/h1,3-7H2,2H3,(H2,10,11);1H |
| InChIKey | UZSLBGUMOUYSPB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|