About 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine
2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 13071524) has the molecular formula C14H12ClNS
and a molecular weight of 261.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 13071524 |
| Molecular Formula | C14H12ClNS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | Clc1ccc(C2CNc3ccccc3S2)cc1 |
| InChI | InChI=1S/C14H12ClNS/c15-11-7-5-10(6-8-11)14-9-16-12-3-1-2-4-13(12)17-14/h1-8,14,16H,9H2 |
| InChIKey | ISPNBZNDOKFUNY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine (CID 13071524) is 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine is Clc1ccc(C2CNc3ccccc3S2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is ISPNBZNDOKFUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNS/c15-11-7-5-10(6-8-11)14-9-16-12-3-1-2-4-13(12)17-14/h1-8,14,16H,9H2.
What are the key properties of 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine?
2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 261.78 g/mol, XLogP of 4.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 13071524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).