About (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol
(2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol (PubChem CID 130718347) has the molecular formula C9H14FN3O
and a molecular weight of 199.23 g/mol. Its IUPAC name is (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol |
| PubChem CID | 130718347 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol |
| SMILES | Cc1nc(C)c(F)c(NC[C@@H](C)O)n1 |
| InChI | InChI=1S/C9H14FN3O/c1-5(14)4-11-9-8(10)6(2)12-7(3)13-9/h5,14H,4H2,1-3H3,(H,11,12,13)/t5-/m1/s1 |
| InChIKey | LDCWWJHHRDHUMJ-RXMQYKEDSA-N |
| XLogP | 1.03 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol?
The IUPAC name of (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol (CID 130718347) is (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol.
What is the SMILES notation for (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol?
The canonical SMILES for (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol is Cc1nc(C)c(F)c(NC[C@@H](C)O)n1.
What is the InChIKey of (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol?
The InChIKey is LDCWWJHHRDHUMJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C9H14FN3O/c1-5(14)4-11-9-8(10)6(2)12-7(3)13-9/h5,14H,4H2,1-3H3,(H,11,12,13)/t5-/m1/s1.
What are the key properties of (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol?
(2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol has a molecular weight of 199.23 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-2-ol is sourced from PubChem (CID 130718347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).