C7H10ClF2NO — CID 130718570
2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide (PubChem CID 130718570) has the molecular formula C7H10ClF2NO and a molecular weight of 197.61 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide.
| Compound Name | 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 130718570 |
| Molecular Formula | C7H10ClF2NO |
| Molecular Weight | 197.61 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide |
| SMILES | CC[C@@H]1C[C@H]1NC(=O)C(F)(F)Cl |
| InChI | InChI=1S/C7H10ClF2NO/c1-2-4-3-5(4)11-6(12)7(8,9)10/h4-5H,2-3H2,1H3,(H,11,12)/t4-,5-/m1/s1 |
| InChIKey | BCNDYOLHMTUXIA-RFZPGFLSSA-N |
| XLogP | 1.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|