About 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide
2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide (PubChem CID 130718570) has the molecular formula C7H10ClF2NO
and a molecular weight of 197.61 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide |
| PubChem CID | 130718570 |
| Molecular Formula | C7H10ClF2NO |
| Molecular Weight | 197.61 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide |
| SMILES | CC[C@@H]1C[C@H]1NC(=O)C(F)(F)Cl |
| InChI | InChI=1S/C7H10ClF2NO/c1-2-4-3-5(4)11-6(12)7(8,9)10/h4-5H,2-3H2,1H3,(H,11,12)/t4-,5-/m1/s1 |
| InChIKey | BCNDYOLHMTUXIA-RFZPGFLSSA-N |
| XLogP | 1.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide?
The IUPAC name of 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide (CID 130718570) is 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide.
What is the SMILES notation for 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide?
The canonical SMILES for 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide is CC[C@@H]1C[C@H]1NC(=O)C(F)(F)Cl.
What is the InChIKey of 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide?
The InChIKey is BCNDYOLHMTUXIA-RFZPGFLSSA-N. The full InChI is InChI=1S/C7H10ClF2NO/c1-2-4-3-5(4)11-6(12)7(8,9)10/h4-5H,2-3H2,1H3,(H,11,12)/t4-,5-/m1/s1.
What are the key properties of 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide?
2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide has a molecular weight of 197.61 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(1R,2R)-2-ethylcyclopropyl]-2,2-difluoroacetamide is sourced from PubChem (CID 130718570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).