About but-2-ynyl 5-bromothiophene-2-carboxylate
but-2-ynyl 5-bromothiophene-2-carboxylate (PubChem CID 130718812) has the molecular formula C9H7BrO2S
and a molecular weight of 259.12 g/mol. Its IUPAC name is but-2-ynyl 5-bromothiophene-2-carboxylate.
Molecular Properties
| Compound Name | but-2-ynyl 5-bromothiophene-2-carboxylate |
| PubChem CID | 130718812 |
| Molecular Formula | C9H7BrO2S |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | but-2-ynyl 5-bromothiophene-2-carboxylate |
| SMILES | CC#CCOC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H7BrO2S/c1-2-3-6-12-9(11)7-4-5-8(10)13-7/h4-5H,6H2,1H3 |
| InChIKey | YDQQNPDWDRYDCO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-ynyl 5-bromothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ynyl 5-bromothiophene-2-carboxylate?
The IUPAC name of but-2-ynyl 5-bromothiophene-2-carboxylate (CID 130718812) is but-2-ynyl 5-bromothiophene-2-carboxylate.
What is the SMILES notation for but-2-ynyl 5-bromothiophene-2-carboxylate?
The canonical SMILES for but-2-ynyl 5-bromothiophene-2-carboxylate is CC#CCOC(=O)c1ccc(Br)s1.
What is the InChIKey of but-2-ynyl 5-bromothiophene-2-carboxylate?
The InChIKey is YDQQNPDWDRYDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO2S/c1-2-3-6-12-9(11)7-4-5-8(10)13-7/h4-5H,6H2,1H3.
What are the key properties of but-2-ynyl 5-bromothiophene-2-carboxylate?
but-2-ynyl 5-bromothiophene-2-carboxylate has a molecular weight of 259.12 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ynyl 5-bromothiophene-2-carboxylate is sourced from PubChem (CID 130718812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).