C11H18N2 — CID 130719228
2-[(1R,6R)-7-azabicyclo[4.2.0]octan-7-yl]butanenitrile (PubChem CID 130719228) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-[(1R,6R)-7-azabicyclo[4.2.0]octan-7-yl]butanenitrile.
| Compound Name | 2-[(1R,6R)-7-azabicyclo[4.2.0]octan-7-yl]butanenitrile |
|---|---|
| PubChem CID | 130719228 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-[(1R,6R)-7-azabicyclo[4.2.0]octan-7-yl]butanenitrile |
| SMILES | CCC(C#N)N1C[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C11H18N2/c1-2-10(7-12)13-8-9-5-3-4-6-11(9)13/h9-11H,2-6,8H2,1H3/t9-,10?,11-/m1/s1 |
| InChIKey | VJXLGZYVFXFNHH-GLYLRITDSA-N |
| XLogP | 2.16 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |