C10H14ClNO — CID 130719261
1-[5-(1-chloroethyl)-2,4-dimethyl-1H-pyrrol-3-yl]ethanone (PubChem CID 130719261) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 1-[5-(1-chloroethyl)-2,4-dimethyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | 1-[5-(1-chloroethyl)-2,4-dimethyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 130719261 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-[5-(1-chloroethyl)-2,4-dimethyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)[nH]c(C(C)Cl)c1C |
| InChI | InChI=1S/C10H14ClNO/c1-5-9(8(4)13)7(3)12-10(5)6(2)11/h6,12H,1-4H3 |
| InChIKey | VYXLXAGJMGADQF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|