About (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate
(3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate (PubChem CID 1307194) has the molecular formula C25H21NO6S
and a molecular weight of 463.51 g/mol. Its IUPAC name is (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate.
Molecular Properties
| Compound Name | (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate |
| PubChem CID | 1307194 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate |
| SMILES | CCN1C(C(=O)c2ccccc2)=C(OC(=O)c2ccccc2OC)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C25H21NO6S/c1-3-26-22(23(27)17-11-5-4-6-12-17)24(19-14-8-10-16-21(19)33(26,29)30)32-25(28)18-13-7-9-15-20(18)31-2/h4-16H,3H2,1-2H3 |
| InChIKey | PGXWMQHVYAXYAA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate?
The IUPAC name of (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate (CID 1307194) is (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate.
What is the SMILES notation for (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate?
The canonical SMILES for (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate is CCN1C(C(=O)c2ccccc2)=C(OC(=O)c2ccccc2OC)c2ccccc2S1(=O)=O.
What is the InChIKey of (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate?
The InChIKey is PGXWMQHVYAXYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO6S/c1-3-26-22(23(27)17-11-5-4-6-12-17)24(19-14-8-10-16-21(19)33(26,29)30)32-25(28)18-13-7-9-15-20(18)31-2/h4-16H,3H2,1-2H3.
What are the key properties of (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate?
(3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate has a molecular weight of 463.51 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-2-ethyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 2-methoxybenzoate is sourced from PubChem (CID 1307194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).