About N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine
N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine (PubChem CID 130719406) has the molecular formula C10H15FN2S
and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine |
| PubChem CID | 130719406 |
| Molecular Formula | C10H15FN2S |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1cnc(N[C@@H]2CCCC[C@H]2F)s1 |
| InChI | InChI=1S/C10H15FN2S/c1-7-6-12-10(14-7)13-9-5-3-2-4-8(9)11/h6,8-9H,2-5H2,1H3,(H,12,13)/t8-,9-/m1/s1 |
| InChIKey | VYSYPJRNGBTKOK-RKDXNWHRSA-N |
| XLogP | 3.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine?
The IUPAC name of N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine (CID 130719406) is N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine?
The canonical SMILES for N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine is Cc1cnc(N[C@@H]2CCCC[C@H]2F)s1.
What is the InChIKey of N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine?
The InChIKey is VYSYPJRNGBTKOK-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H15FN2S/c1-7-6-12-10(14-7)13-9-5-3-2-4-8(9)11/h6,8-9H,2-5H2,1H3,(H,12,13)/t8-,9-/m1/s1.
What are the key properties of N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine?
N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine has a molecular weight of 214.31 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-fluorocyclohexyl]-5-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 130719406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).