C7H11N3OS — CID 130719874
3-methylsulfanyl-5-(oxolan-2-yl)-1H-1,2,4-triazole (PubChem CID 130719874) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-methylsulfanyl-5-(oxolan-2-yl)-1H-1,2,4-triazole.
| Compound Name | 3-methylsulfanyl-5-(oxolan-2-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 130719874 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3-methylsulfanyl-5-(oxolan-2-yl)-1H-1,2,4-triazole |
| SMILES | CSc1n[nH]c(C2CCCO2)n1 |
| InChI | InChI=1S/C7H11N3OS/c1-12-7-8-6(9-10-7)5-3-2-4-11-5/h5H,2-4H2,1H3,(H,8,9,10) |
| InChIKey | JHUVYDATVSRPIG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |