About 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one
5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one (PubChem CID 1307220) has the molecular formula C19H15ClO5
and a molecular weight of 358.78 g/mol. Its IUPAC name is 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one.
Molecular Properties
| Compound Name | 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one |
| PubChem CID | 1307220 |
| Molecular Formula | C19H15ClO5 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one |
| SMILES | Cc1cc(OCc2cc3c(cc2Cl)OCO3)c2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H15ClO5/c1-10-3-16(19-11(2)5-18(21)25-17(19)4-10)22-8-12-6-14-15(7-13(12)20)24-9-23-14/h3-7H,8-9H2,1-2H3 |
| InChIKey | IOWRZONBLOYOQS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one?
The IUPAC name of 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one (CID 1307220) is 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one.
What is the SMILES notation for 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one?
The canonical SMILES for 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one is Cc1cc(OCc2cc3c(cc2Cl)OCO3)c2c(C)cc(=O)oc2c1.
What is the InChIKey of 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one?
The InChIKey is IOWRZONBLOYOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClO5/c1-10-3-16(19-11(2)5-18(21)25-17(19)4-10)22-8-12-6-14-15(7-13(12)20)24-9-23-14/h3-7H,8-9H2,1-2H3.
What are the key properties of 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one?
5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one has a molecular weight of 358.78 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-chloro-1,3-benzodioxol-5-yl)methoxy]-4,7-dimethylchromen-2-one is sourced from PubChem (CID 1307220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).