C8H7FINO — CID 130722439
(3S)-4-fluoro-5-iodo-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130722439) has the molecular formula C8H7FINO and a molecular weight of 279.05 g/mol. Its IUPAC name is (3S)-4-fluoro-5-iodo-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3S)-4-fluoro-5-iodo-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130722439 |
| Molecular Formula | C8H7FINO |
| Molecular Weight | 279.05 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | (3S)-4-fluoro-5-iodo-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | N[C@@H]1COc2ccc(I)c(F)c21 |
| InChI | InChI=1S/C8H7FINO/c9-8-4(10)1-2-6-7(8)5(11)3-12-6/h1-2,5H,3,11H2/t5-/m1/s1 |
| InChIKey | USGLZBFQGZCMGC-RXMQYKEDSA-N |
| XLogP | 1.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.05 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|