C10H16N2O2 — CID 130723648
(3R)-3-amino-3-(3,4,5-trimethyl-1H-pyrrol-2-yl)propanoic acid (PubChem CID 130723648) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3R)-3-amino-3-(3,4,5-trimethyl-1H-pyrrol-2-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(3,4,5-trimethyl-1H-pyrrol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 130723648 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (3R)-3-amino-3-(3,4,5-trimethyl-1H-pyrrol-2-yl)propanoic acid |
| SMILES | Cc1[nH]c([C@H](N)CC(=O)O)c(C)c1C |
| InChI | InChI=1S/C10H16N2O2/c1-5-6(2)10(12-7(5)3)8(11)4-9(13)14/h8,12H,4,11H2,1-3H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | KRRXXNALCJGMJP-MRVPVSSYSA-N |
| XLogP | 1.41 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |