About ethyl N'-cyclopentylcarbamimidothioate;hydroiodide
ethyl N'-cyclopentylcarbamimidothioate;hydroiodide (PubChem CID 130723685) has the molecular formula C8H17IN2S
and a molecular weight of 300.21 g/mol. Its IUPAC name is ethyl N'-cyclopentylcarbamimidothioate;hydroiodide.
Molecular Properties
| Compound Name | ethyl N'-cyclopentylcarbamimidothioate;hydroiodide |
| PubChem CID | 130723685 |
| Molecular Formula | C8H17IN2S |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | ethyl N'-cyclopentylcarbamimidothioate;hydroiodide |
| SMILES | CCS/C(N)=N\C1CCCC1.I |
| InChI | InChI=1S/C8H16N2S.HI/c1-2-11-8(9)10-7-5-3-4-6-7;/h7H,2-6H2,1H3,(H2,9,10);1H |
| InChIKey | FTRRWZFRIQDHRJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl N'-cyclopentylcarbamimidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N'-cyclopentylcarbamimidothioate;hydroiodide?
The IUPAC name of ethyl N'-cyclopentylcarbamimidothioate;hydroiodide (CID 130723685) is ethyl N'-cyclopentylcarbamimidothioate;hydroiodide.
What is the SMILES notation for ethyl N'-cyclopentylcarbamimidothioate;hydroiodide?
The canonical SMILES for ethyl N'-cyclopentylcarbamimidothioate;hydroiodide is CCS/C(N)=N\C1CCCC1.I.
What is the InChIKey of ethyl N'-cyclopentylcarbamimidothioate;hydroiodide?
The InChIKey is FTRRWZFRIQDHRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S.HI/c1-2-11-8(9)10-7-5-3-4-6-7;/h7H,2-6H2,1H3,(H2,9,10);1H.
What are the key properties of ethyl N'-cyclopentylcarbamimidothioate;hydroiodide?
ethyl N'-cyclopentylcarbamimidothioate;hydroiodide has a molecular weight of 300.21 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N'-cyclopentylcarbamimidothioate;hydroiodide is sourced from PubChem (CID 130723685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).