C10H16O5 — CID 13072433
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) butanoate (PubChem CID 13072433) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) butanoate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) butanoate |
|---|---|
| PubChem CID | 13072433 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) butanoate |
| SMILES | CCCC(=O)OC1COC2C(O)COC12 |
| InChI | InChI=1S/C10H16O5/c1-2-3-8(12)15-7-5-14-9-6(11)4-13-10(7)9/h6-7,9-11H,2-5H2,1H3 |
| InChIKey | IJEFSNISNQFLNH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |