C11H18O5 — CID 13072435
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate (PubChem CID 13072435) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate |
|---|---|
| PubChem CID | 13072435 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) pentanoate |
| SMILES | CCCCC(=O)OC1COC2C(O)COC12 |
| InChI | InChI=1S/C11H18O5/c1-2-3-4-9(13)16-8-6-15-10-7(12)5-14-11(8)10/h7-8,10-12H,2-6H2,1H3 |
| InChIKey | VMZIZPVLLXQYBP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |