About 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide
4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide (PubChem CID 130725413) has the molecular formula C7H5ClN2OS
and a molecular weight of 200.65 g/mol. Its IUPAC name is 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 130725413 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide |
| SMILES | C#CCNC(=O)c1nc(Cl)cs1 |
| InChI | InChI=1S/C7H5ClN2OS/c1-2-3-9-6(11)7-10-5(8)4-12-7/h1,4H,3H2,(H,9,11) |
| InChIKey | NAKZYNPHXVTFMU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide (CID 130725413) is 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide is C#CCNC(=O)c1nc(Cl)cs1.
What is the InChIKey of 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide?
The InChIKey is NAKZYNPHXVTFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2OS/c1-2-3-9-6(11)7-10-5(8)4-12-7/h1,4H,3H2,(H,9,11).
What are the key properties of 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide?
4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide has a molecular weight of 200.65 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-prop-2-ynyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130725413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).