C6H13NS2 — CID 13072565
(4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane (PubChem CID 13072565) has the molecular formula C6H13NS2 and a molecular weight of 163.31 g/mol. Its IUPAC name is (4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane.
| Compound Name | (4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 13072565 |
| Molecular Formula | C6H13NS2 |
| Molecular Weight | 163.31 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane |
| SMILES | CC1S[C@H](C)N[C@H](C)S1 |
| InChI | InChI=1S/C6H13NS2/c1-4-7-5(2)9-6(3)8-4/h4-7H,1-3H3/t4-,5+,6? |
| InChIKey | FBMVFHKKLDGLJA-XEAPYIEGSA-N |
| XLogP | 2.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |