About 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide
4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide (PubChem CID 130725665) has the molecular formula C9H18FNOS
and a molecular weight of 207.31 g/mol. Its IUPAC name is 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide.
Analyze 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide?
The IUPAC name of 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide (CID 130725665) is 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide?
The canonical SMILES for 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide is CC1C(C)S(=O)CCN1CCCF.
What is the InChIKey of 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide?
The InChIKey is OPHUGXCZYQKOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18FNOS/c1-8-9(2)13(12)7-6-11(8)5-3-4-10/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide?
4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide has a molecular weight of 207.31 g/mol, XLogP of 1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoropropyl)-2,3-dimethyl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 130725665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).