About cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate
cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate (PubChem CID 130725731) has the molecular formula C6H3BrN2O2S
and a molecular weight of 247.07 g/mol. Its IUPAC name is cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate |
| PubChem CID | 130725731 |
| Molecular Formula | C6H3BrN2O2S |
| Molecular Weight | 247.07 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate |
| SMILES | N#CCOC(=O)c1ncsc1Br |
| InChI | InChI=1S/C6H3BrN2O2S/c7-5-4(9-3-12-5)6(10)11-2-1-8/h3H,2H2 |
| InChIKey | OOEUNBVQAKJWDC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.07 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate?
The IUPAC name of cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate (CID 130725731) is cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate.
What is the SMILES notation for cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate?
The canonical SMILES for cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate is N#CCOC(=O)c1ncsc1Br.
What is the InChIKey of cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate?
The InChIKey is OOEUNBVQAKJWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2O2S/c7-5-4(9-3-12-5)6(10)11-2-1-8/h3H,2H2.
What are the key properties of cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate?
cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate has a molecular weight of 247.07 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 5-bromo-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 130725731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).