C11H22O2 — CID 13072640
(4R,5R)-2,2-dimethyl-4,5-di(propan-2-yl)-1,3-dioxolane (PubChem CID 13072640) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-4,5-di(propan-2-yl)-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2-dimethyl-4,5-di(propan-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 13072640 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-4,5-di(propan-2-yl)-1,3-dioxolane |
| SMILES | CC(C)[C@H]1OC(C)(C)O[C@@H]1C(C)C |
| InChI | InChI=1S/C11H22O2/c1-7(2)9-10(8(3)4)13-11(5,6)12-9/h7-10H,1-6H3/t9-,10-/m1/s1 |
| InChIKey | NYNMFBIZDGKYBJ-NXEZZACHSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |