About magnesium;2-methanidylhexa-1,5-diene;chloride
magnesium;2-methanidylhexa-1,5-diene;chloride (PubChem CID 13072713) has the molecular formula C7H11ClMg
and a molecular weight of 154.92 g/mol. Its IUPAC name is magnesium;2-methanidylhexa-1,5-diene;chloride.
Molecular Properties
| Compound Name | magnesium;2-methanidylhexa-1,5-diene;chloride |
| PubChem CID | 13072713 |
| Molecular Formula | C7H11ClMg |
| Molecular Weight | 154.92 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | magnesium;2-methanidylhexa-1,5-diene;chloride |
| SMILES | C=CCCC(=C)[CH2-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C7H11.ClH.Mg/c1-4-5-6-7(2)3;;/h4H,1-3,5-6H2;1H;/q-1;;+2/p-1 |
| InChIKey | MXHGLHAMUJLDTC-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.92 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-methanidylhexa-1,5-diene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methanidylhexa-1,5-diene;chloride?
The IUPAC name of magnesium;2-methanidylhexa-1,5-diene;chloride (CID 13072713) is magnesium;2-methanidylhexa-1,5-diene;chloride.
What is the SMILES notation for magnesium;2-methanidylhexa-1,5-diene;chloride?
The canonical SMILES for magnesium;2-methanidylhexa-1,5-diene;chloride is C=CCCC(=C)[CH2-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;2-methanidylhexa-1,5-diene;chloride?
The InChIKey is MXHGLHAMUJLDTC-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H11.ClH.Mg/c1-4-5-6-7(2)3;;/h4H,1-3,5-6H2;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2-methanidylhexa-1,5-diene;chloride?
magnesium;2-methanidylhexa-1,5-diene;chloride has a molecular weight of 154.92 g/mol, XLogP of -1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methanidylhexa-1,5-diene;chloride is sourced from PubChem (CID 13072713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).