About 1-carbazol-9-yl-2,2,2-trifluoroethanone
1-carbazol-9-yl-2,2,2-trifluoroethanone (PubChem CID 13072859) has the molecular formula C14H8F3NO
and a molecular weight of 263.22 g/mol. Its IUPAC name is 1-carbazol-9-yl-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-carbazol-9-yl-2,2,2-trifluoroethanone |
| PubChem CID | 13072859 |
| Molecular Formula | C14H8F3NO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-carbazol-9-yl-2,2,2-trifluoroethanone |
| SMILES | O=C(n1c2ccccc2c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C14H8F3NO/c15-14(16,17)13(19)18-11-7-3-1-5-9(11)10-6-2-4-8-12(10)18/h1-8H |
| InChIKey | GAYGDUSZOFOTQY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-carbazol-9-yl-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbazol-9-yl-2,2,2-trifluoroethanone?
The IUPAC name of 1-carbazol-9-yl-2,2,2-trifluoroethanone (CID 13072859) is 1-carbazol-9-yl-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-carbazol-9-yl-2,2,2-trifluoroethanone?
The canonical SMILES for 1-carbazol-9-yl-2,2,2-trifluoroethanone is O=C(n1c2ccccc2c2ccccc21)C(F)(F)F.
What is the InChIKey of 1-carbazol-9-yl-2,2,2-trifluoroethanone?
The InChIKey is GAYGDUSZOFOTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F3NO/c15-14(16,17)13(19)18-11-7-3-1-5-9(11)10-6-2-4-8-12(10)18/h1-8H.
What are the key properties of 1-carbazol-9-yl-2,2,2-trifluoroethanone?
1-carbazol-9-yl-2,2,2-trifluoroethanone has a molecular weight of 263.22 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbazol-9-yl-2,2,2-trifluoroethanone is sourced from PubChem (CID 13072859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).