C20H32O2 — CID 13072948
(2S,4aS,4bS,8S,8aR,10aS)-8-but-3-ynyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol (PubChem CID 13072948) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2S,4aS,4bS,8S,8aR,10aS)-8-but-3-ynyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol.
| Compound Name | (2S,4aS,4bS,8S,8aR,10aS)-8-but-3-ynyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 13072948 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2S,4aS,4bS,8S,8aR,10aS)-8-but-3-ynyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol |
| SMILES | C#CCC[C@H]1[C@@H]2CC[C@H]3C[C@@H](O)CC[C@]3(C)[C@H]2CCC1(C)O |
| InChI | InChI=1S/C20H32O2/c1-4-5-6-18-16-8-7-14-13-15(21)9-11-19(14,2)17(16)10-12-20(18,3)22/h1,14-18,21-22H,5-13H2,2-3H3/t14-,15-,16+,17-,18-,19-,20?/m0/s1 |
| InChIKey | HENOOEVZNMJWBX-GXSANFBDSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|