C21H34O2 — CID 13072950
(2S,4aS,4bS,8S,8aR,10aS)-4a,7-dimethyl-8-pent-3-ynyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol (PubChem CID 13072950) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (2S,4aS,4bS,8S,8aR,10aS)-4a,7-dimethyl-8-pent-3-ynyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol.
| Compound Name | (2S,4aS,4bS,8S,8aR,10aS)-4a,7-dimethyl-8-pent-3-ynyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 13072950 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (2S,4aS,4bS,8S,8aR,10aS)-4a,7-dimethyl-8-pent-3-ynyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-2,7-diol |
| SMILES | CC#CCC[C@H]1[C@@H]2CC[C@H]3C[C@@H](O)CC[C@]3(C)[C@H]2CCC1(C)O |
| InChI | InChI=1S/C21H34O2/c1-4-5-6-7-19-17-9-8-15-14-16(22)10-12-20(15,2)18(17)11-13-21(19,3)23/h15-19,22-23H,6-14H2,1-3H3/t15-,16-,17+,18-,19-,20-,21?/m0/s1 |
| InChIKey | OOHGLOSYHKESCI-TWZNBOBPSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|