C11H14N2O2 — CID 130730289
2-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydropyran-4-one (PubChem CID 130730289) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 130730289 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)-2,3-dihydropyran-4-one |
| SMILES | Cc1nn(C)c(C)c1C1CC(=O)C=CO1 |
| InChI | InChI=1S/C11H14N2O2/c1-7-11(8(2)13(3)12-7)10-6-9(14)4-5-15-10/h4-5,10H,6H2,1-3H3 |
| InChIKey | LCSYIZLDCNZQQB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |