C9H14Cl2N4 — CID 13073049
3,6-dichloro-N,N-dipropyl-1,2,4-triazin-5-amine (PubChem CID 13073049) has the molecular formula C9H14Cl2N4 and a molecular weight of 249.14 g/mol. Its IUPAC name is 3,6-dichloro-N,N-dipropyl-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N,N-dipropyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 13073049 |
| Molecular Formula | C9H14Cl2N4 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3,6-dichloro-N,N-dipropyl-1,2,4-triazin-5-amine |
| SMILES | CCCN(CCC)c1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H14Cl2N4/c1-3-5-15(6-4-2)8-7(10)13-14-9(11)12-8/h3-6H2,1-2H3 |
| InChIKey | BQASICKOVSRYBX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |