C10H14F3N3O2 — CID 130730956
tert-butyl N-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]carbamate (PubChem CID 130730956) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is tert-butyl N-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 130730956 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | tert-butyl N-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]carbamate |
| SMILES | Cn1ncc(NC(=O)OC(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O2/c1-9(2,3)18-8(17)15-6-5-14-16(4)7(6)10(11,12)13/h5H,1-4H3,(H,15,17) |
| InChIKey | USYVGPSTSOGVSE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |