C11H18N2O — CID 130731224
4-amino-2-[(1R)-1-amino-2,2-dimethylpropyl]phenol (PubChem CID 130731224) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-amino-2-[(1R)-1-amino-2,2-dimethylpropyl]phenol.
| Compound Name | 4-amino-2-[(1R)-1-amino-2,2-dimethylpropyl]phenol |
|---|---|
| PubChem CID | 130731224 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-amino-2-[(1R)-1-amino-2,2-dimethylpropyl]phenol |
| SMILES | CC(C)(C)[C@@H](N)c1cc(N)ccc1O |
| InChI | InChI=1S/C11H18N2O/c1-11(2,3)10(13)8-6-7(12)4-5-9(8)14/h4-6,10,14H,12-13H2,1-3H3/t10-/m0/s1 |
| InChIKey | VKCZTTKPNAEPAV-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|