C9H8ClN3S — CID 130731616
(5-chloro-2-pyridinyl)-(1,2-thiazol-3-yl)methanamine (PubChem CID 130731616) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is (5-chloro-2-pyridinyl)-(1,2-thiazol-3-yl)methanamine.
| Compound Name | (5-chloro-2-pyridinyl)-(1,2-thiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 130731616 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | (5-chloro-2-pyridinyl)-(1,2-thiazol-3-yl)methanamine |
| SMILES | NC(c1ccc(Cl)cn1)c1ccsn1 |
| InChI | InChI=1S/C9H8ClN3S/c10-6-1-2-7(12-5-6)9(11)8-3-4-14-13-8/h1-5,9H,11H2 |
| InChIKey | DWDONKAZNNXKHT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |