4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid

C10H7FN2O2S — CID 13073208

IUPAC4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid
SMILESNc1c(-c2ccc(F)cc2)nsc1C(=O)O
InChIInChI=1S/C10H7FN2O2S/c11-6-3-1-5(2-4-6)8-7(12)9(10(14)15)16-13-8/h1-4H,12H2,(H,14,15)
InChIKeyUWVZJPQYRGOTSB-UHFFFAOYSA-N
MW238.24 g/mol
LogP2.23
Rot. Bonds2

About 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid

4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 13073208) has the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid
PubChem CID13073208
Molecular FormulaC10H7FN2O2S
Molecular Weight238.24 g/mol
Exact Mass238.02
IUPAC Name4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid
SMILESNc1c(-c2ccc(F)cc2)nsc1C(=O)O
InChIInChI=1S/C10H7FN2O2S/c11-6-3-1-5(2-4-6)8-7(12)9(10(14)15)16-13-8/h1-4H,12H2,(H,14,15)
InChIKeyUWVZJPQYRGOTSB-UHFFFAOYSA-N
XLogP2.23
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 52.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid (CID 13073208) is 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid is Nc1c(-c2ccc(F)cc2)nsc1C(=O)O.
What is the InChIKey of 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid?
The InChIKey is UWVZJPQYRGOTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O2S/c11-6-3-1-5(2-4-6)8-7(12)9(10(14)15)16-13-8/h1-4H,12H2,(H,14,15).
What are the key properties of 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid?
4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid has a molecular weight of 238.24 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(4-fluorophenyl)-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 13073208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).