C10H19FN2 — CID 130734906
(3aS,6aR)-5-(3-fluoropropyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 130734906) has the molecular formula C10H19FN2 and a molecular weight of 186.27 g/mol. Its IUPAC name is (3aS,6aR)-5-(3-fluoropropyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-(3-fluoropropyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 130734906 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (3aS,6aR)-5-(3-fluoropropyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1C[C@@H]2CN(CCCF)C[C@@H]2C1 |
| InChI | InChI=1S/C10H19FN2/c1-12-5-9-7-13(4-2-3-11)8-10(9)6-12/h9-10H,2-8H2,1H3/t9-,10+ |
| InChIKey | KEYCKDUXCOKJIX-AOOOYVTPSA-N |
| XLogP | 0.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |