About N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide
N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide (PubChem CID 130735034) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 130735034 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ncc[nH]1)c1cocn1 |
| InChI | InChI=1S/C7H6N4O2/c12-6(5-3-13-4-10-5)11-7-8-1-2-9-7/h1-4H,(H2,8,9,11,12) |
| InChIKey | MHRLCMOBGUMPBB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide (CID 130735034) is N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide is O=C(Nc1ncc[nH]1)c1cocn1.
What is the InChIKey of N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide?
The InChIKey is MHRLCMOBGUMPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c12-6(5-3-13-4-10-5)11-7-8-1-2-9-7/h1-4H,(H2,8,9,11,12).
What are the key properties of N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide?
N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide has a molecular weight of 178.15 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-imidazol-2-yl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 130735034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).