About N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide
N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 130735090) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide |
| PubChem CID | 130735090 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | CCN(C)C(=O)c1cc(=O)[nH]o1 |
| InChI | InChI=1S/C7H10N2O3/c1-3-9(2)7(11)5-4-6(10)8-12-5/h4H,3H2,1-2H3,(H,8,10) |
| InChIKey | OGNWMVOSYOYMGL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide?
The IUPAC name of N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide (CID 130735090) is N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide is CCN(C)C(=O)c1cc(=O)[nH]o1.
What is the InChIKey of N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide?
The InChIKey is OGNWMVOSYOYMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-3-9(2)7(11)5-4-6(10)8-12-5/h4H,3H2,1-2H3,(H,8,10).
What are the key properties of N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide?
N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide has a molecular weight of 170.17 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-3-oxo-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 130735090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).