C10H11NOS2 — CID 130736495
(3-ethylthiophen-2-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 130736495) has the molecular formula C10H11NOS2 and a molecular weight of 225.34 g/mol. Its IUPAC name is (3-ethylthiophen-2-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (3-ethylthiophen-2-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130736495 |
| Molecular Formula | C10H11NOS2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | (3-ethylthiophen-2-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | CCc1ccsc1C(O)c1ccsn1 |
| InChI | InChI=1S/C10H11NOS2/c1-2-7-3-5-13-10(7)9(12)8-4-6-14-11-8/h3-6,9,12H,2H2,1H3 |
| InChIKey | UHPBBLOHGVJWBP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |