C12H17FN2 — CID 130736594
4-(3,3-diethylazetidin-1-yl)-2-fluoropyridine (PubChem CID 130736594) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 4-(3,3-diethylazetidin-1-yl)-2-fluoropyridine.
| Compound Name | 4-(3,3-diethylazetidin-1-yl)-2-fluoropyridine |
|---|---|
| PubChem CID | 130736594 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 4-(3,3-diethylazetidin-1-yl)-2-fluoropyridine |
| SMILES | CCC1(CC)CN(c2ccnc(F)c2)C1 |
| InChI | InChI=1S/C12H17FN2/c1-3-12(4-2)8-15(9-12)10-5-6-14-11(13)7-10/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | FHEIJUWVYVSLMR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|