About [(2S,3S)-2-chloropentan-3-yl] formate
[(2S,3S)-2-chloropentan-3-yl] formate (PubChem CID 130737322) has the molecular formula C6H11ClO2
and a molecular weight of 150.60 g/mol. Its IUPAC name is [(2S,3S)-2-chloropentan-3-yl] formate.
Molecular Properties
| Compound Name | [(2S,3S)-2-chloropentan-3-yl] formate |
| PubChem CID | 130737322 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | [(2S,3S)-2-chloropentan-3-yl] formate |
| SMILES | CC[C@H](OC=O)[C@H](C)Cl |
| InChI | InChI=1S/C6H11ClO2/c1-3-6(5(2)7)9-4-8/h4-6H,3H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | JRYIGYJRBIAAOU-WDSKDSINSA-N |
| XLogP | 1.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-2-chloropentan-3-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-chloropentan-3-yl] formate?
The IUPAC name of [(2S,3S)-2-chloropentan-3-yl] formate (CID 130737322) is [(2S,3S)-2-chloropentan-3-yl] formate.
What is the SMILES notation for [(2S,3S)-2-chloropentan-3-yl] formate?
The canonical SMILES for [(2S,3S)-2-chloropentan-3-yl] formate is CC[C@H](OC=O)[C@H](C)Cl.
What is the InChIKey of [(2S,3S)-2-chloropentan-3-yl] formate?
The InChIKey is JRYIGYJRBIAAOU-WDSKDSINSA-N. The full InChI is InChI=1S/C6H11ClO2/c1-3-6(5(2)7)9-4-8/h4-6H,3H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of [(2S,3S)-2-chloropentan-3-yl] formate?
[(2S,3S)-2-chloropentan-3-yl] formate has a molecular weight of 150.60 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-chloropentan-3-yl] formate is sourced from PubChem (CID 130737322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).