About 4-methyl-2,5-dioxopyrrole-3-carbaldehyde
4-methyl-2,5-dioxopyrrole-3-carbaldehyde (PubChem CID 130737483) has the molecular formula C6H5NO3
and a molecular weight of 139.11 g/mol. Its IUPAC name is 4-methyl-2,5-dioxopyrrole-3-carbaldehyde.
Molecular Properties
| Compound Name | 4-methyl-2,5-dioxopyrrole-3-carbaldehyde |
| PubChem CID | 130737483 |
| Molecular Formula | C6H5NO3 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 4-methyl-2,5-dioxopyrrole-3-carbaldehyde |
| SMILES | CC1=C(C=O)C(=O)NC1=O |
| InChI | InChI=1S/C6H5NO3/c1-3-4(2-8)6(10)7-5(3)9/h2H,1H3,(H,7,9,10) |
| InChIKey | NEXJRZBJUYPZGT-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,5-dioxopyrrole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,5-dioxopyrrole-3-carbaldehyde?
The IUPAC name of 4-methyl-2,5-dioxopyrrole-3-carbaldehyde (CID 130737483) is 4-methyl-2,5-dioxopyrrole-3-carbaldehyde.
What is the SMILES notation for 4-methyl-2,5-dioxopyrrole-3-carbaldehyde?
The canonical SMILES for 4-methyl-2,5-dioxopyrrole-3-carbaldehyde is CC1=C(C=O)C(=O)NC1=O.
What is the InChIKey of 4-methyl-2,5-dioxopyrrole-3-carbaldehyde?
The InChIKey is NEXJRZBJUYPZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3/c1-3-4(2-8)6(10)7-5(3)9/h2H,1H3,(H,7,9,10).
What are the key properties of 4-methyl-2,5-dioxopyrrole-3-carbaldehyde?
4-methyl-2,5-dioxopyrrole-3-carbaldehyde has a molecular weight of 139.11 g/mol, XLogP of -0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,5-dioxopyrrole-3-carbaldehyde is sourced from PubChem (CID 130737483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).