C8H16OS2 — CID 130737864
(1S)-1-(2-ethyl-1,3-dithian-2-yl)ethanol (PubChem CID 130737864) has the molecular formula C8H16OS2 and a molecular weight of 192.35 g/mol. Its IUPAC name is (1S)-1-(2-ethyl-1,3-dithian-2-yl)ethanol.
| Compound Name | (1S)-1-(2-ethyl-1,3-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 130737864 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1S)-1-(2-ethyl-1,3-dithian-2-yl)ethanol |
| SMILES | CCC1([C@H](C)O)SCCCS1 |
| InChI | InChI=1S/C8H16OS2/c1-3-8(7(2)9)10-5-4-6-11-8/h7,9H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | XEODTIGANXJTKZ-ZETCQYMHSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |