About 2-but-2-ynyl-1,1-dimethylguanidine
2-but-2-ynyl-1,1-dimethylguanidine (PubChem CID 130738544) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-but-2-ynyl-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-but-2-ynyl-1,1-dimethylguanidine |
| PubChem CID | 130738544 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-but-2-ynyl-1,1-dimethylguanidine |
| SMILES | CC#CC/N=C(\N)N(C)C |
| InChI | InChI=1S/C7H13N3/c1-4-5-6-9-7(8)10(2)3/h6H2,1-3H3,(H2,8,9) |
| InChIKey | GIWCTYPCFLJAPJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-ynyl-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-ynyl-1,1-dimethylguanidine?
The IUPAC name of 2-but-2-ynyl-1,1-dimethylguanidine (CID 130738544) is 2-but-2-ynyl-1,1-dimethylguanidine.
What is the SMILES notation for 2-but-2-ynyl-1,1-dimethylguanidine?
The canonical SMILES for 2-but-2-ynyl-1,1-dimethylguanidine is CC#CC/N=C(\N)N(C)C.
What is the InChIKey of 2-but-2-ynyl-1,1-dimethylguanidine?
The InChIKey is GIWCTYPCFLJAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-4-5-6-9-7(8)10(2)3/h6H2,1-3H3,(H2,8,9).
What are the key properties of 2-but-2-ynyl-1,1-dimethylguanidine?
2-but-2-ynyl-1,1-dimethylguanidine has a molecular weight of 139.20 g/mol, XLogP of -0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-ynyl-1,1-dimethylguanidine is sourced from PubChem (CID 130738544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).